| Name |
3'-methoxy-N-(octahydrobenzo[b][1,4]dioxin-6-yl)-[1,1'-biphenyl]-4-carboxamide
|
| Molecular Formula |
C22H25NO4
|
| Molecular Weight |
367.4
|
| Smiles |
COc1cccc(-c2ccc(C(=O)NC3CCC4OCCOC4C3)cc2)c1
|
COc1cccc(-c2ccc(C(=O)NC3CCC4OCCOC4C3)cc2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.