| Name |
Indole-3-carbinol, tert-butyldimethylsilyl ether
|
| Molecular Formula |
C15H23NOSi
|
| Molecular Weight |
261.43
|
| Smiles |
CC(C)(C)[Si](C)(C)OCc1c[nH]c2ccccc12
|
CC(C)(C)[Si](C)(C)OCc1c[nH]c2ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.