| Name |
N-(3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl)-2-methoxynicotinamide
|
| Molecular Formula |
C15H16N6O2
|
| Molecular Weight |
312.33
|
| Smiles |
COc1ncccc1C(=O)NCCCc1cnc2ncnn2c1
|
COc1ncccc1C(=O)NCCCc1cnc2ncnn2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.