| Name |
2-(3,5-dichloro-2-pyridinyl)-2H-1,2,3-Triazol-4-amine
|
| Molecular Formula |
C7H5Cl2N5
|
| Molecular Weight |
230.05
|
| Smiles |
Nc1cnn(-c2ncc(Cl)cc2Cl)n1
|
Nc1cnn(-c2ncc(Cl)cc2Cl)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.