| Name |
N-(cyanomethyl)-2-{7-thia-9,11-diazatricyclo[6.4.0.0^{2,6}]dodeca-1(12),2(6),8,10-tetraen-12-ylsulfanyl}acetamide
|
| Molecular Formula |
C13H12N4OS2
|
| Molecular Weight |
304.4
|
| Smiles |
N#CCNC(=O)CSc1ncnc2sc3c(c12)CCC3
|
N#CCNC(=O)CSc1ncnc2sc3c(c12)CCC3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.