| Name |
6-(bromomethyl)-3,3-diethylbenzo[c][1,2]oxaborol-1(3H)-ol
|
| Molecular Formula |
C12H16BBrO2
|
| Molecular Weight |
282.97
|
| Smiles |
CCC1(CC)OB(O)c2cc(CBr)ccc21
|
CCC1(CC)OB(O)c2cc(CBr)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.