| Name |
4,6,7-trifluoro-3,3-dimethyl-2,3-dihydro-1H-indole
|
| Molecular Formula |
C10H10F3N
|
| Molecular Weight |
201.19
|
| Smiles |
CC1(C)CNc2c(F)c(F)cc(F)c21
|
CC1(C)CNc2c(F)c(F)cc(F)c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.