| Name |
8-chloro-2-(3,4-difluorobenzyl)-3,4-dihydro-2,7-naphthyridin-1(2H)-one
|
| Molecular Formula |
C15H11ClF2N2O
|
| Molecular Weight |
308.71
|
| Smiles |
O=C1c2c(ccnc2Cl)CCN1Cc1ccc(F)c(F)c1
|
O=C1c2c(ccnc2Cl)CCN1Cc1ccc(F)c(F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.