| Name |
6,7,7a,8-Tetrahydro-10-methoxy-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-9-ol
|
| Molecular Formula |
C18H17NO4
|
| Molecular Weight |
311.3
|
| Smiles |
COc1ccc2c(c1O)CC1NCCc3cc4c(c-2c31)OCO4
|
COc1ccc2c(c1O)CC1NCCc3cc4c(c-2c31)OCO4
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.