| Name |
Di-tert-butyl (4-{[tert-butyl(dimethyl)silyl]oxy}butyl)imidodicarbonate
|
| Molecular Formula |
C20H41NO5Si
|
| Molecular Weight |
403.6
|
| Smiles |
CC(C)(C)OC(=O)N(CCCCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C
|
CC(C)(C)OC(=O)N(CCCCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.