| Name |
3-Pyridinamine, 6-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-
|
| Molecular Formula |
C13H9ClN4O
|
| Molecular Weight |
272.69
|
| Smiles |
Nc1ccc(-c2nc(-c3cccc(Cl)c3)no2)nc1
|
Nc1ccc(-c2nc(-c3cccc(Cl)c3)no2)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.