| Name |
2-Methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyridazin-3-one
|
| Molecular Formula |
C11H17BN2O3
|
| Molecular Weight |
236.08
|
| Smiles |
Cn1ncc(B2OC(C)(C)C(C)(C)O2)cc1=O
|
Cn1ncc(B2OC(C)(C)C(C)(C)O2)cc1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.