| Name |
3-Bromo-5-methoxy-N-(2,2,2-trifluoroethyl)aniline
|
| Molecular Formula |
C9H9BrF3NO
|
| Molecular Weight |
284.07
|
| Smiles |
COc1cc(Br)cc(NCC(F)(F)F)c1
|
COc1cc(Br)cc(NCC(F)(F)F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.