| Name |
2-(Methylsulfonyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
|
| Molecular Formula |
C8H11N3O2S
|
| Molecular Weight |
213.26
|
| Smiles |
CS(=O)(=O)c1ncc2c(n1)CCNC2
|
CS(=O)(=O)c1ncc2c(n1)CCNC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.