| Name |
4'-Chloro-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde
|
| Molecular Formula |
C13H13ClO
|
| Molecular Weight |
220.69
|
| Smiles |
O=CC1=C(c2ccc(Cl)cc2)CCCC1
|
O=CC1=C(c2ccc(Cl)cc2)CCCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.