| Name |
1H-Pyrazole-3-carboxylic acid, 4-chloro-5-(2,4-difluorophenyl)-
|
| Molecular Formula |
C10H5ClF2N2O2
|
| Molecular Weight |
258.61
|
| Smiles |
O=C(O)c1[nH]nc(-c2ccc(F)cc2F)c1Cl
|
O=C(O)c1[nH]nc(-c2ccc(F)cc2F)c1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.