| Name |
2-(6-Bromo-5-methyl-2,4-dioxo-1,2-dihydrothieno[2,3-d]pyrimidin-3(4H)-yl)-2-methylpropanoic acid
|
| Molecular Formula |
C11H11BrN2O4S
|
| Molecular Weight |
347.19
|
| Smiles |
Cc1c(Br)sc2[nH]c(=O)n(C(C)(C)C(=O)O)c(=O)c12
|
Cc1c(Br)sc2[nH]c(=O)n(C(C)(C)C(=O)O)c(=O)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.