| Name |
N-Guanylurea-dinitramide
|
| Molecular Formula |
C2H10N8O5
|
| Molecular Weight |
226.15
|
| Smiles |
NC(=O)N=C(N)N.N[N+](=O)[O-].N[N+](=O)[O-]
|
NC(=O)N=C(N)N.N[N+](=O)[O-].N[N+](=O)[O-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.