| Name |
1-(3-Buten-1-yl)-1,2,3,4-tetrahydro-6,7-dimethoxyisoquinoline
|
| Molecular Formula |
C15H21NO2
|
| Molecular Weight |
247.33
|
| Smiles |
C=CCCC1NCCc2cc(OC)c(OC)cc21
|
C=CCCC1NCCc2cc(OC)c(OC)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.