| Name |
1-Isoquinolinepropanoic acid, 1,2,3,4-tetrahydro-5,6-dimethoxy-
|
| Molecular Formula |
C14H19NO4
|
| Molecular Weight |
265.30
|
| Smiles |
COc1ccc2c(c1OC)CCNC2CCC(=O)O
|
COc1ccc2c(c1OC)CCNC2CCC(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.