| Name |
methyl 2-amino-3-(1H-1,2,3-triazol-1-yl)butanoate hydrochloride
|
| Molecular Formula |
C7H13ClN4O2
|
| Molecular Weight |
220.66
|
| Smiles |
COC(=O)C(N)C(C)n1ccnn1.Cl
|
COC(=O)C(N)C(C)n1ccnn1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.