| Name |
6-(1,1,2,2,2-Pentafluoroethyl)pyridine-3,4-diamine
|
| Molecular Formula |
C7H6F5N3
|
| Molecular Weight |
227.13
|
| Smiles |
Nc1cnc(C(F)(F)C(F)(F)F)cc1N
|
Nc1cnc(C(F)(F)C(F)(F)F)cc1N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.