| Name |
5-(2-{6-Chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl}ethyl)-3-(2-methoxyphenyl)-1,2,4-oxadiazole
|
| Molecular Formula |
C16H13ClN6O2
|
| Molecular Weight |
356.76
|
| Smiles |
COc1ccccc1-c1noc(CCc2nnc3ccc(Cl)nn23)n1
|
COc1ccccc1-c1noc(CCc2nnc3ccc(Cl)nn23)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.