| Name |
3-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine
|
| Molecular Formula |
C12H13FN4
|
| Molecular Weight |
232.26
|
| Smiles |
NC1CCc2nnc(-c3ccccc3F)n2C1
|
NC1CCc2nnc(-c3ccccc3F)n2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.