| Name |
{1-[(3,4-difluorophenyl)methyl]-1H-1,2,3-triazol-4-yl}methanamine
|
| Molecular Formula |
C10H10F2N4
|
| Molecular Weight |
224.21
|
| Smiles |
NCc1cn(Cc2ccc(F)c(F)c2)nn1
|
NCc1cn(Cc2ccc(F)c(F)c2)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.