| Name |
N-[({[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl}sulfanyl)methanimidoyl]guanidine
|
| Molecular Formula |
C12H12ClN5OS
|
| Molecular Weight |
309.78
|
| Smiles |
N=C(N=C(N)N)SCc1ncc(-c2cccc(Cl)c2)o1
|
N=C(N=C(N)N)SCc1ncc(-c2cccc(Cl)c2)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.