| Name |
Perfluoropropane-1,3-disulfonic acid lithium salt
|
| Molecular Formula |
C3F6Li2O6S2
|
| Molecular Weight |
324.1
|
| Smiles |
O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[Li+].[Li+]
|
O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[Li+].[Li+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.