| Name |
6-(2-Chlorophenyl)-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-3-amine
|
| Molecular Formula |
C9H6ClN5S
|
| Molecular Weight |
251.70
|
| Smiles |
Nc1nnc2sc(-c3ccccc3Cl)nn12
|
Nc1nnc2sc(-c3ccccc3Cl)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.