| Name |
1-Hydroxy-1-oxo-5,8,11,14-tetraoxa-2-azahexadecan-16-oic acid
|
| Molecular Formula |
C11H21NO8
|
| Molecular Weight |
295.29
|
| Smiles |
O=C(O)COCCOCCOCCOCCNC(=O)O
|
O=C(O)COCCOCCOCCOCCNC(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.