| Name |
1H-Pyrrole-2-carboxylic acid, 4-methyl-, 1H-benzotriazol-1-yl ester
|
| Molecular Formula |
C12H10N4O2
|
| Molecular Weight |
242.23
|
| Smiles |
Cc1c[nH]c(C(=O)On2nnc3ccccc32)c1
|
Cc1c[nH]c(C(=O)On2nnc3ccccc32)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.