| Name |
[2-(2,3-Dihydro-1,4-benzodioxin-6-yl)propan-2-yl](methyl)amine
|
| Molecular Formula |
C12H17NO2
|
| Molecular Weight |
207.27
|
| Smiles |
CNC(C)(C)c1ccc2c(c1)OCCO2
|
CNC(C)(C)c1ccc2c(c1)OCCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.