| Name |
Thieno[2,3-d]pyrimidine-3(2H)-acetic acid, 6-(ethoxycarbonyl)-1,4-dihydro-alpha,alpha,5-trimethyl-2,4-dioxo-, 1,1-dimethylethyl ester
|
| Molecular Formula |
C18H24N2O6S
|
| Molecular Weight |
396.5
|
| Smiles |
CCOC(=O)c1sc2[nH]c(=O)n(C(C)(C)C(=O)OC(C)(C)C)c(=O)c2c1C
|
CCOC(=O)c1sc2[nH]c(=O)n(C(C)(C)C(=O)OC(C)(C)C)c(=O)c2c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.