| Name |
1-(prop-2-yn-1-yl)-N-(4-{[5-(trifluoromethyl)pyridin-2-yl]amino}phenyl)piperidine-4-carboxamide
|
| Molecular Formula |
C21H21F3N4O
|
| Molecular Weight |
402.4
|
| Smiles |
C#CCN1CCC(C(=O)Nc2ccc(Nc3ccc(C(F)(F)F)cn3)cc2)CC1
|
C#CCN1CCC(C(=O)Nc2ccc(Nc3ccc(C(F)(F)F)cn3)cc2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.