| Name |
1-Bromo-4-chloro-7,8-dimethylimidazo[1,2-A]quinoxaline
|
| Molecular Formula |
C12H9BrClN3
|
| Molecular Weight |
310.58
|
| Smiles |
Cc1cc2nc(Cl)c3ncc(Br)n3c2cc1C
|
Cc1cc2nc(Cl)c3ncc(Br)n3c2cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.