| Name |
N-(1,3-benzodioxol-5-ylmethyl)-6-[1-[(3-chlorophenyl)methyl]-2,4-dioxo-4a,7a-dihydrothieno[3,2-d]pyrimidin-3-yl]hexanamide
|
| Molecular Formula |
C27H28ClN3O5S
|
| Molecular Weight |
542.0
|
| Smiles |
O=C(CCCCCN1C(=O)C2SC=CC2N(Cc2cccc(Cl)c2)C1=O)NCc1ccc2c(c1)OCO2
|
O=C(CCCCCN1C(=O)C2SC=CC2N(Cc2cccc(Cl)c2)C1=O)NCc1ccc2c(c1)OCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.