| Name |
3-Chloro-5-(2,5-dimethoxyphenyl)-1,2,4-triazine
|
| Molecular Formula |
C11H10ClN3O2
|
| Molecular Weight |
251.67
|
| Smiles |
COc1ccc(OC)c(-c2cnnc(Cl)n2)c1
|
COc1ccc(OC)c(-c2cnnc(Cl)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.