| Name |
5h-Pyrazolo[4,3-c]pyridine,5-methyl-3-phenyl-,monohydriodide
|
| Molecular Formula |
C13H12IN3
|
| Molecular Weight |
337.16
|
| Smiles |
Cn1ccc2nnc(-c3ccccc3)c-2c1.I
|
Cn1ccc2nnc(-c3ccccc3)c-2c1.I
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.