| Name |
3-(6-Methyl-1',2',3',4',5',6'-hexahydro-[2,4']bipyridinyl-4-yl)-propionic acid ethyl ester dihydrochloride
|
| Molecular Formula |
C16H26Cl2N2O2
|
| Molecular Weight |
349.3
|
| Smiles |
CCOC(=O)CCc1cc(C)nc(C2CCNCC2)c1.Cl.Cl
|
CCOC(=O)CCc1cc(C)nc(C2CCNCC2)c1.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.