| Name |
N-{2-[4-cyclopropyl-5-oxo-3-(pyridin-3-yl)-4,5-dihydro-1H-1,2,4-triazol-1-yl]ethyl}-4-propyl-1,2,3-thiadiazole-5-carboxamide
|
| Molecular Formula |
C18H21N7O2S
|
| Molecular Weight |
399.5
|
| Smiles |
CCCc1nnsc1C(=O)NCCn1nc(-c2cccnc2)n(C2CC2)c1=O
|
CCCc1nnsc1C(=O)NCCn1nc(-c2cccnc2)n(C2CC2)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.