| Name | 3-(3-hydroxypropyl)-1,7-dimethyl-8-(propan-2-yl)-1H,2H,3H,4H,8H-imidazo[1,2-g]purine-2,4-dione | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C15H22N5O3+ | 
                        
                        
                            | Molecular Weight | 320.37 | 
                        
                        
                            | Smiles | Cc1c[n+]2c(n1C(C)C)N=C1C2C(=O)N(CCCO)C(=O)N1C | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        Cc1c[n+]2c(n1C(C)C)N=C1C2C(=O)N(CCCO)C(=O)N1C
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.