| Name |
2-Ethoxy-N-(2-{[3-(furan-2-YL)-1,2,4-oxadiazol-5-YL]methyl}phenyl)benzamide
|
| Molecular Formula |
C22H19N3O4
|
| Molecular Weight |
389.4
|
| Smiles |
CCOc1ccccc1C(=O)Nc1ccccc1Cc1nc(-c2ccco2)no1
|
CCOc1ccccc1C(=O)Nc1ccccc1Cc1nc(-c2ccco2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.