| Name |
methyl 2-{2-[2-(naphthalen-1-yl)-4-oxo-4H,5H-pyrazolo[1,5-d][1,2,4]triazin-5-yl]acetamido}benzoate
|
| Molecular Formula |
C25H23N5O4
|
| Molecular Weight |
457.5
|
| Smiles |
COC(=O)c1ccccc1NC(=O)CN1N=CN2NC(c3cccc4ccccc34)CC2C1=O
|
COC(=O)c1ccccc1NC(=O)CN1N=CN2NC(c3cccc4ccccc34)CC2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.