| Name |
3-(3,4-difluorophenyl)-N-[(1S)-1-(ethylcarbamoyl)-2,2-dimethyl-propyl]-7,8-dimethyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide
|
| Molecular Formula |
C24H33F2N5O2
|
| Molecular Weight |
461.5
|
| Smiles |
CCNC(=O)C(NC(=O)c1nc(-c2ccc(F)c(F)c2)n2c1CN(C)C(C)CC2)C(C)(C)C
|
CCNC(=O)C(NC(=O)c1nc(-c2ccc(F)c(F)c2)n2c1CN(C)C(C)CC2)C(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.