| Name |
4-methyl-11-(5-methyl-1-phenyl-1H-pyrazole-4-carbonyl)-2,3,7,11-tetraazatricyclo[7.4.0.0^{2,6}]trideca-1(9),3,5,7-tetraene
|
| Molecular Formula |
C21H20N6O
|
| Molecular Weight |
372.4
|
| Smiles |
Cc1cc2ncc3c(n2n1)CCN(C(=O)c1cnn(-c2ccccc2)c1C)C3
|
Cc1cc2ncc3c(n2n1)CCN(C(=O)c1cnn(-c2ccccc2)c1C)C3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.