| Name |
B-(2,3-Dihydronaphtho[1,8-bc]pyran-7-yl)boronic acid
|
| Molecular Formula |
C12H11BO3
|
| Molecular Weight |
214.03
|
| Smiles |
OB(O)c1ccc2c3c(cccc13)CCO2
|
OB(O)c1ccc2c3c(cccc13)CCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.