| Name |
cyclo[Ac5c-DL-Trp-DL-Lys(Bz)(Bz)-DL-Pro-DL-Oic(3axi,7axi)-DL-Trp]
|
| Molecular Formula |
C55H65N9O7
|
| Molecular Weight |
964.2
|
| Smiles |
O=C(NCCCCC1NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C2(CCCC2)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C2CC3CCCCC3N2C(=O)C2CCCN2C1=O)c1ccccc1
|
O=C(NCCCCC1NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C2(CCCC2)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C2CC3CCCCC3N2C(=O)C2CCCN2C1=O)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.