| Name |
3-Amino-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid dihydrochloride
|
| Molecular Formula |
C8H14Cl2N2O2S
|
| Molecular Weight |
273.18
|
| Smiles |
Cc1nc(C(C)(N)CC(=O)O)cs1.Cl.Cl
|
Cc1nc(C(C)(N)CC(=O)O)cs1.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.