| Name |
7-benzyl-1,3-dimethyl-8-octylsulfanyl-5H-purin-7-ium-2,6-dione
|
| Molecular Formula |
C22H31N4O2S+
|
| Molecular Weight |
415.6
|
| Smiles |
CCCCCCCCSC1=[N+](Cc2ccccc2)C2C(=O)N(C)C(=O)N(C)C2=N1
|
CCCCCCCCSC1=[N+](Cc2ccccc2)C2C(=O)N(C)C(=O)N(C)C2=N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.