| Name |
3-heptyl-9-(4-methoxyphenyl)-1,7-dimethyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione
|
| Molecular Formula |
C24H37N5O3
|
| Molecular Weight |
443.6
|
| Smiles |
CCCCCCCN1C(=O)C2C(NC3N(c4ccc(OC)cc4)CC(C)CN23)N(C)C1=O
|
CCCCCCCN1C(=O)C2C(NC3N(c4ccc(OC)cc4)CC(C)CN23)N(C)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.