| Name |
N~2~-1,3-benzodioxol-5-yl-6-methylpyrimidine-2,4-diamine hydrochloride
|
| Molecular Formula |
C12H13ClN4O2
|
| Molecular Weight |
280.71
|
| Smiles |
Cc1cc(N)nc(Nc2ccc3c(c2)OCO3)n1.Cl
|
Cc1cc(N)nc(Nc2ccc3c(c2)OCO3)n1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.